C13H34O5Si4 — CID 71337602
dimethylsilyloxy-[dimethylsilyloxy(dimethyl)silyl]oxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 71337602) has the molecular formula C13H34O5Si4 and a molecular weight of 382.75 g/mol. Its IUPAC name is dimethylsilyloxy-[dimethylsilyloxy(dimethyl)silyl]oxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | dimethylsilyloxy-[dimethylsilyloxy(dimethyl)silyl]oxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 71337602 |
| Molecular Formula | C13H34O5Si4 |
| Molecular Weight | 382.75 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | dimethylsilyloxy-[dimethylsilyloxy(dimethyl)silyl]oxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | C[SiH](C)O[Si](C)(C)O[Si](C)(CCCOCC1CO1)O[SiH](C)C |
| InChI | InChI=1S/C13H34O5Si4/c1-19(2)16-21(5,6)18-22(7,17-20(3)4)10-8-9-14-11-13-12-15-13/h13,19-20H,8-12H2,1-7H3 |
| InChIKey | DOFBBJRTZOOXQU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.75 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|