C34H88O14Si11 — CID 88854641
bis[[[[[[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy]-dimethylsilane (PubChem CID 88854641) has the molecular formula C34H88O14Si11 and a molecular weight of 1030.01 g/mol. Its IUPAC name is bis[[[[[[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy]-dimethylsilane.
| Compound Name | bis[[[[[[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 88854641 |
| Molecular Formula | C34H88O14Si11 |
| Molecular Weight | 1030.01 g/mol |
| Exact Mass | 1028.36 |
| IUPAC Name | bis[[[[[[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy]-dimethylsilane |
| SMILES | C[Si](C)(CCCOCC1CO1)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCOCC1CO1 |
| InChI | InChI=1S/C34H88O14Si11/c1-49(2,27-23-25-35-29-33-31-37-33)39-51(5,6)41-53(9,10)43-55(13,14)45-57(17,18)47-59(21,22)48-58(19,20)46-56(15,16)44-54(11,12)42-52(7,8)40-50(3,4)28-24-26-36-30-34-32-38-34/h33-34H,23-32H2,1-22H3 |
| InChIKey | KOZDPUHWPCKBFI-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 135.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1030.01 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|