C32H68O12Si5 — CID 59734838
tetrakis[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl] silicate (PubChem CID 59734838) has the molecular formula C32H68O12Si5 and a molecular weight of 785.31 g/mol. Its IUPAC name is tetrakis[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl] silicate.
| Compound Name | tetrakis[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl] silicate |
|---|---|
| PubChem CID | 59734838 |
| Molecular Formula | C32H68O12Si5 |
| Molecular Weight | 785.31 g/mol |
| Exact Mass | 784.36 |
| IUPAC Name | tetrakis[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl] silicate |
| SMILES | C[Si](C)(CCCOCC1CO1)O[Si](O[Si](C)(C)CCCOCC1CO1)(O[Si](C)(C)CCCOCC1CO1)O[Si](C)(C)CCCOCC1CO1 |
| InChI | InChI=1S/C32H68O12Si5/c1-45(2,17-9-13-33-21-29-25-37-29)41-49(42-46(3,4)18-10-14-34-22-30-26-38-30,43-47(5,6)19-11-15-35-23-31-27-39-31)44-48(7,8)20-12-16-36-24-32-28-40-32/h29-32H,9-28H2,1-8H3 |
| InChIKey | DWUJGFHUOHDVAW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 123.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.31 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|