C11H26O3Si2 — CID 99864615
dimethyl-[3-[[(2R)-oxiran-2-yl]methoxy]propyl]-trimethylsilyloxysilane (PubChem CID 99864615) has the molecular formula C11H26O3Si2 and a molecular weight of 262.50 g/mol. Its IUPAC name is dimethyl-[3-[[(2R)-oxiran-2-yl]methoxy]propyl]-trimethylsilyloxysilane.
| Compound Name | dimethyl-[3-[[(2R)-oxiran-2-yl]methoxy]propyl]-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 99864615 |
| Molecular Formula | C11H26O3Si2 |
| Molecular Weight | 262.50 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | dimethyl-[3-[[(2R)-oxiran-2-yl]methoxy]propyl]-trimethylsilyloxysilane |
| SMILES | C[Si](C)(C)O[Si](C)(C)CCCOC[C@H]1CO1 |
| InChI | InChI=1S/C11H26O3Si2/c1-15(2,3)14-16(4,5)8-6-7-12-9-11-10-13-11/h11H,6-10H2,1-5H3/t11-/m0/s1 |
| InChIKey | OYWALDPIZVWXIM-NSHDSACASA-N |
| XLogP | 2.85 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|