C13H32O5Si3 — CID 59476089
[dimethyl(trimethylsilyloxy)silyl]oxy-methoxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 59476089) has the molecular formula C13H32O5Si3 and a molecular weight of 352.65 g/mol. Its IUPAC name is [dimethyl(trimethylsilyloxy)silyl]oxy-methoxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | [dimethyl(trimethylsilyloxy)silyl]oxy-methoxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 59476089 |
| Molecular Formula | C13H32O5Si3 |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | [dimethyl(trimethylsilyloxy)silyl]oxy-methoxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | CO[Si](C)(CCCOCC1CO1)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C13H32O5Si3/c1-14-21(7,10-8-9-15-11-13-12-16-13)18-20(5,6)17-19(2,3)4/h13H,8-12H2,1-7H3 |
| InChIKey | TVGLUUNBOPHKDC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|