C15H40O6Si5 — CID 59933218
[dimethyl-[methyl-(oxiran-2-ylmethoxymethyl)-trimethylsilyloxysilyl]oxysilyl]oxy-dimethyl-trimethylsilyloxysilane (PubChem CID 59933218) has the molecular formula C15H40O6Si5 and a molecular weight of 456.91 g/mol. Its IUPAC name is [dimethyl-[methyl-(oxiran-2-ylmethoxymethyl)-trimethylsilyloxysilyl]oxysilyl]oxy-dimethyl-trimethylsilyloxysilane.
| Compound Name | [dimethyl-[methyl-(oxiran-2-ylmethoxymethyl)-trimethylsilyloxysilyl]oxysilyl]oxy-dimethyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 59933218 |
| Molecular Formula | C15H40O6Si5 |
| Molecular Weight | 456.91 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | [dimethyl-[methyl-(oxiran-2-ylmethoxymethyl)-trimethylsilyloxysilyl]oxysilyl]oxy-dimethyl-trimethylsilyloxysilane |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(COCC1CO1)O[Si](C)(C)C |
| InChI | InChI=1S/C15H40O6Si5/c1-22(2,3)18-24(7,8)20-25(9,10)21-26(11,19-23(4,5)6)14-16-12-15-13-17-15/h15H,12-14H2,1-11H3 |
| InChIKey | GRIQNYVRADQLHC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.91 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|