C17H46O6Si5 — CID 21339785
bis[[dimethyl(trimethylsilyloxy)silyl]oxy]-(4-methoxybutoxymethyl)-methylsilane (PubChem CID 21339785) has the molecular formula C17H46O6Si5 and a molecular weight of 486.98 g/mol. Its IUPAC name is bis[[dimethyl(trimethylsilyloxy)silyl]oxy]-(4-methoxybutoxymethyl)-methylsilane.
| Compound Name | bis[[dimethyl(trimethylsilyloxy)silyl]oxy]-(4-methoxybutoxymethyl)-methylsilane |
|---|---|
| PubChem CID | 21339785 |
| Molecular Formula | C17H46O6Si5 |
| Molecular Weight | 486.98 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | bis[[dimethyl(trimethylsilyloxy)silyl]oxy]-(4-methoxybutoxymethyl)-methylsilane |
| SMILES | COCCCCOC[Si](C)(O[Si](C)(C)O[Si](C)(C)C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H46O6Si5/c1-18-15-13-14-16-19-17-28(12,22-26(8,9)20-24(2,3)4)23-27(10,11)21-25(5,6)7/h13-17H2,1-12H3 |
| InChIKey | BHKOBHFJNMCHRB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.98 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|