C10H30O3Si4 — CID 8852
[dimethyl(trimethylsilyloxy)silyl]oxy-dimethyl-trimethylsilyloxysilane (PubChem CID 8852) has the molecular formula C10H30O3Si4 and a molecular weight of 310.69 g/mol. Its IUPAC name is [dimethyl(trimethylsilyloxy)silyl]oxy-dimethyl-trimethylsilyloxysilane.
| Compound Name | [dimethyl(trimethylsilyloxy)silyl]oxy-dimethyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 8852 |
| Molecular Formula | C10H30O3Si4 |
| Molecular Weight | 310.69 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | [dimethyl(trimethylsilyloxy)silyl]oxy-dimethyl-trimethylsilyloxysilane |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C10H30O3Si4/c1-14(2,3)11-16(7,8)13-17(9,10)12-15(4,5)6/h1-10H3 |
| InChIKey | YFCGDEUVHLPRCZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.69 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|