C12H37ClO5Si6 — CID 173337322
[chloro(methyl)silyl]oxy-[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane (PubChem CID 173337322) has the molecular formula C12H37ClO5Si6 and a molecular weight of 465.39 g/mol. Its IUPAC name is [chloro(methyl)silyl]oxy-[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane.
| Compound Name | [chloro(methyl)silyl]oxy-[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 173337322 |
| Molecular Formula | C12H37ClO5Si6 |
| Molecular Weight | 465.39 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | [chloro(methyl)silyl]oxy-[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane |
| SMILES | C[SiH](Cl)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C12H37ClO5Si6/c1-19(13)14-21(5,6)16-23(9,10)18-24(11,12)17-22(7,8)15-20(2,3)4/h19H,1-12H3 |
| InChIKey | WOBGLQVNSFQFCC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|