C9H30O3Si3 — CID 158103585
[dimethyl(trimethylsilyloxy)silyl]oxy-hydroxy-dimethylsilane;methane (PubChem CID 158103585) has the molecular formula C9H30O3Si3 and a molecular weight of 270.59 g/mol. Its IUPAC name is [dimethyl(trimethylsilyloxy)silyl]oxy-hydroxy-dimethylsilane;methane.
| Compound Name | [dimethyl(trimethylsilyloxy)silyl]oxy-hydroxy-dimethylsilane;methane |
|---|---|
| PubChem CID | 158103585 |
| Molecular Formula | C9H30O3Si3 |
| Molecular Weight | 270.59 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | [dimethyl(trimethylsilyloxy)silyl]oxy-hydroxy-dimethylsilane;methane |
| SMILES | C.C.C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O |
| InChI | InChI=1S/C7H22O3Si3.2CH4/c1-11(2,3)9-13(6,7)10-12(4,5)8;;/h8H,1-7H3;2*1H4 |
| InChIKey | FPOIPZQTTKIUBM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.59 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|