C19H44O4Si4 — CID 153308404
dicyclohexyl-[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-trimethylsilyloxysilane (PubChem CID 153308404) has the molecular formula C19H44O4Si4 and a molecular weight of 448.90 g/mol. Its IUPAC name is dicyclohexyl-[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-trimethylsilyloxysilane.
| Compound Name | dicyclohexyl-[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 153308404 |
| Molecular Formula | C19H44O4Si4 |
| Molecular Weight | 448.90 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | dicyclohexyl-[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-trimethylsilyloxysilane |
| SMILES | C[Si](C)(C)O[Si](O[Si](C)(C)O[Si](C)(C)O)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C19H44O4Si4/c1-24(2,3)21-27(18-14-10-8-11-15-18,19-16-12-9-13-17-19)23-26(6,7)22-25(4,5)20/h18-20H,8-17H2,1-7H3 |
| InChIKey | RYGZZGLDXGCWTM-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.90 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|