C20H60O8Si9 — CID 101457215
tetrakis[dimethyl(trimethylsilyloxy)silyl] silicate (PubChem CID 101457215) has the molecular formula C20H60O8Si9 and a molecular weight of 681.47 g/mol. Its IUPAC name is tetrakis[dimethyl(trimethylsilyloxy)silyl] silicate.
| Compound Name | tetrakis[dimethyl(trimethylsilyloxy)silyl] silicate |
|---|---|
| PubChem CID | 101457215 |
| Molecular Formula | C20H60O8Si9 |
| Molecular Weight | 681.47 g/mol |
| Exact Mass | 680.22 |
| IUPAC Name | tetrakis[dimethyl(trimethylsilyloxy)silyl] silicate |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](O[Si](C)(C)O[Si](C)(C)C)(O[Si](C)(C)O[Si](C)(C)C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C20H60O8Si9/c1-29(2,3)21-33(13,14)25-37(26-34(15,16)22-30(4,5)6,27-35(17,18)23-31(7,8)9)28-36(19,20)24-32(10,11)12/h1-20H3 |
| InChIKey | GIWGRGIETZHVTE-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.47 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|