C10H30O2Si4 — CID 13440564
[dimethyl(trimethylsilyloxy)silyl]oxy-dimethyl-trimethylsilylsilane (PubChem CID 13440564) has the molecular formula C10H30O2Si4 and a molecular weight of 294.69 g/mol. Its IUPAC name is [dimethyl(trimethylsilyloxy)silyl]oxy-dimethyl-trimethylsilylsilane.
| Compound Name | [dimethyl(trimethylsilyloxy)silyl]oxy-dimethyl-trimethylsilylsilane |
|---|---|
| PubChem CID | 13440564 |
| Molecular Formula | C10H30O2Si4 |
| Molecular Weight | 294.69 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | [dimethyl(trimethylsilyloxy)silyl]oxy-dimethyl-trimethylsilylsilane |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)[Si](C)(C)C |
| InChI | InChI=1S/C10H30O2Si4/c1-13(2,3)11-15(7,8)12-16(9,10)14(4,5)6/h1-10H3 |
| InChIKey | YZNBINKSQHFYCN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.69 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|