C28H80O10Si11 — CID 59289806
bis[[[[[dimethyl(trimethylsilyloxy)silyl]oxy-ethyl-methylsilyl]oxy-dimethylsilyl]oxy-ethyl-methylsilyl]oxy]-dimethylsilane (PubChem CID 59289806) has the molecular formula C28H80O10Si11 and a molecular weight of 885.88 g/mol. Its IUPAC name is bis[[[[[dimethyl(trimethylsilyloxy)silyl]oxy-ethyl-methylsilyl]oxy-dimethylsilyl]oxy-ethyl-methylsilyl]oxy]-dimethylsilane.
| Compound Name | bis[[[[[dimethyl(trimethylsilyloxy)silyl]oxy-ethyl-methylsilyl]oxy-dimethylsilyl]oxy-ethyl-methylsilyl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 59289806 |
| Molecular Formula | C28H80O10Si11 |
| Molecular Weight | 885.88 g/mol |
| Exact Mass | 884.32 |
| IUPAC Name | bis[[[[[dimethyl(trimethylsilyloxy)silyl]oxy-ethyl-methylsilyl]oxy-dimethylsilyl]oxy-ethyl-methylsilyl]oxy]-dimethylsilane |
| SMILES | CC[Si](C)(O[Si](C)(C)O[Si](C)(C)C)O[Si](C)(C)O[Si](C)(CC)O[Si](C)(C)O[Si](C)(CC)O[Si](C)(C)O[Si](C)(CC)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C28H80O10Si11/c1-25-46(21,31-41(11,12)29-39(5,6)7)33-43(15,16)35-48(23,27-3)37-45(19,20)38-49(24,28-4)36-44(17,18)34-47(22,26-2)32-42(13,14)30-40(8,9)10/h25-28H2,1-24H3 |
| InChIKey | ZADHYWQQSSYTKE-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.88 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|