C15H42O4Si5 — CID 20825042
butyl-bis[[dimethyl(trimethylsilyloxy)silyl]oxy]-methylsilane (PubChem CID 20825042) has the molecular formula C15H42O4Si5 and a molecular weight of 426.93 g/mol. Its IUPAC name is butyl-bis[[dimethyl(trimethylsilyloxy)silyl]oxy]-methylsilane.
| Compound Name | butyl-bis[[dimethyl(trimethylsilyloxy)silyl]oxy]-methylsilane |
|---|---|
| PubChem CID | 20825042 |
| Molecular Formula | C15H42O4Si5 |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | butyl-bis[[dimethyl(trimethylsilyloxy)silyl]oxy]-methylsilane |
| SMILES | CCCC[Si](C)(O[Si](C)(C)O[Si](C)(C)C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H42O4Si5/c1-13-14-15-24(12,18-22(8,9)16-20(2,3)4)19-23(10,11)17-21(5,6)7/h13-15H2,1-12H3 |
| InChIKey | YFWVDXNWXFMQGX-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|