C15H42NO3Si4+ — CID 23523174
3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propyl-trimethylazanium (PubChem CID 23523174) has the molecular formula C15H42NO3Si4+ and a molecular weight of 396.85 g/mol. Its IUPAC name is 3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propyl-trimethylazanium.
| Compound Name | 3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propyl-trimethylazanium |
|---|---|
| PubChem CID | 23523174 |
| Molecular Formula | C15H42NO3Si4+ |
| Molecular Weight | 396.85 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H42NO3Si4/c1-16(2,3)14-13-15-23(12,18-21(7,8)9)19-22(10,11)17-20(4,5)6/h13-15H2,1-12H3/q+1 |
| InChIKey | QALSNALHMHUWJN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.85 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|