C14H38O4Si4 — CID 162254059
dimethyl-[methyl-trimethylsilyloxy-[3-(2-tritioethoxy)propyl]silyl]oxy-trimethylsilyloxysilane (PubChem CID 162254059) has the molecular formula C14H38O4Si4 and a molecular weight of 384.81 g/mol. Its IUPAC name is dimethyl-[methyl-trimethylsilyloxy-[3-(2-tritioethoxy)propyl]silyl]oxy-trimethylsilyloxysilane.
| Compound Name | dimethyl-[methyl-trimethylsilyloxy-[3-(2-tritioethoxy)propyl]silyl]oxy-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 162254059 |
| Molecular Formula | C14H38O4Si4 |
| Molecular Weight | 384.81 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | dimethyl-[methyl-trimethylsilyloxy-[3-(2-tritioethoxy)propyl]silyl]oxy-trimethylsilyloxysilane |
| SMILES | [3H]CCOCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C14H38O4Si4/c1-11-15-13-12-14-22(10,17-20(5,6)7)18-21(8,9)16-19(2,3)4/h11-14H2,1-10H3/i1T |
| InChIKey | ZYJCPIKRCNJEQZ-CNRUNOGKSA-N |
| XLogP | 4.91 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.81 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|