C15H40O3Si4 — CID 58022647
[dimethyl(trimethylsilyloxy)silyl]oxy-hexyl-methyl-trimethylsilyloxysilane (PubChem CID 58022647) has the molecular formula C15H40O3Si4 and a molecular weight of 380.83 g/mol. Its IUPAC name is [dimethyl(trimethylsilyloxy)silyl]oxy-hexyl-methyl-trimethylsilyloxysilane.
| Compound Name | [dimethyl(trimethylsilyloxy)silyl]oxy-hexyl-methyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 58022647 |
| Molecular Formula | C15H40O3Si4 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | [dimethyl(trimethylsilyloxy)silyl]oxy-hexyl-methyl-trimethylsilyloxysilane |
| SMILES | CCCCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H40O3Si4/c1-11-12-13-14-15-22(10,17-20(5,6)7)18-21(8,9)16-19(2,3)4/h11-15H2,1-10H3 |
| InChIKey | GZASINJWISYOML-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|