C16H44O4Si5 — CID 167428332
[[dimethyl(trimethylsilyloxy)silyl]oxy-methylsilyl]oxy-hexyl-methyl-trimethylsilyloxysilane (PubChem CID 167428332) has the molecular formula C16H44O4Si5 and a molecular weight of 440.95 g/mol. Its IUPAC name is [[dimethyl(trimethylsilyloxy)silyl]oxy-methylsilyl]oxy-hexyl-methyl-trimethylsilyloxysilane.
| Compound Name | [[dimethyl(trimethylsilyloxy)silyl]oxy-methylsilyl]oxy-hexyl-methyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 167428332 |
| Molecular Formula | C16H44O4Si5 |
| Molecular Weight | 440.95 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | [[dimethyl(trimethylsilyloxy)silyl]oxy-methylsilyl]oxy-hexyl-methyl-trimethylsilyloxysilane |
| SMILES | CCCCCC[Si](C)(O[SiH](C)O[Si](C)(C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H44O4Si5/c1-12-13-14-15-16-25(11,20-23(6,7)8)18-21(2)17-24(9,10)19-22(3,4)5/h21H,12-16H2,1-11H3 |
| InChIKey | HVXFIGFFOVFKBJ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.95 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|