C22H56O7Si5 — CID 163704378
2-[3-[methyl-[methyl-[methyl(trimethylsilyloxy)silyl]oxy-octylsilyl]oxy-trimethylsilyloxysilyl]propoxy]ethane-1,1-diol (PubChem CID 163704378) has the molecular formula C22H56O7Si5 and a molecular weight of 573.11 g/mol. Its IUPAC name is 2-[3-[methyl-[methyl-[methyl(trimethylsilyloxy)silyl]oxy-octylsilyl]oxy-trimethylsilyloxysilyl]propoxy]ethane-1,1-diol.
| Compound Name | 2-[3-[methyl-[methyl-[methyl(trimethylsilyloxy)silyl]oxy-octylsilyl]oxy-trimethylsilyloxysilyl]propoxy]ethane-1,1-diol |
|---|---|
| PubChem CID | 163704378 |
| Molecular Formula | C22H56O7Si5 |
| Molecular Weight | 573.11 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | 2-[3-[methyl-[methyl-[methyl(trimethylsilyloxy)silyl]oxy-octylsilyl]oxy-trimethylsilyloxysilyl]propoxy]ethane-1,1-diol |
| SMILES | CCCCCCCC[Si](C)(O[SiH](C)O[Si](C)(C)C)O[Si](C)(CCCOCC(O)O)O[Si](C)(C)C |
| InChI | InChI=1S/C22H56O7Si5/c1-11-12-13-14-15-16-19-33(9,27-30(2)26-31(3,4)5)29-34(10,28-32(6,7)8)20-17-18-25-21-22(23)24/h22-24,30H,11-21H2,1-10H3 |
| InChIKey | WNQJHPBFJHMPAX-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.11 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|