C16H42O7Si4 — CID 163679889
2-[2-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propoxy]ethoxy]ethane-1,1-diol (PubChem CID 163679889) has the molecular formula C16H42O7Si4 and a molecular weight of 458.85 g/mol. Its IUPAC name is 2-[2-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propoxy]ethoxy]ethane-1,1-diol.
| Compound Name | 2-[2-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propoxy]ethoxy]ethane-1,1-diol |
|---|---|
| PubChem CID | 163679889 |
| Molecular Formula | C16H42O7Si4 |
| Molecular Weight | 458.85 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 2-[2-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propoxy]ethoxy]ethane-1,1-diol |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(CCCOCCOCC(O)O)O[Si](C)(C)C |
| InChI | InChI=1S/C16H42O7Si4/c1-24(2,3)21-26(7,8)23-27(9,22-25(4,5)6)14-10-11-19-12-13-20-15-16(17)18/h16-18H,10-15H2,1-9H3 |
| InChIKey | LMGDKYIWBVGZQG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.85 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|