C10H26O4Si2 — CID 163940247
2-[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]ethane-1,1-diol (PubChem CID 163940247) has the molecular formula C10H26O4Si2 and a molecular weight of 266.49 g/mol. Its IUPAC name is 2-[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]ethane-1,1-diol.
| Compound Name | 2-[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]ethane-1,1-diol |
|---|---|
| PubChem CID | 163940247 |
| Molecular Formula | C10H26O4Si2 |
| Molecular Weight | 266.49 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]ethane-1,1-diol |
| SMILES | C[Si](C)(C)O[Si](C)(C)CCCOCC(O)O |
| InChI | InChI=1S/C10H26O4Si2/c1-15(2,3)14-16(4,5)8-6-7-13-9-10(11)12/h10-12H,6-9H2,1-5H3 |
| InChIKey | KGCBHSXFZJCPTG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|