C20H50O6Si4 — CID 153425788
(2S,3R)-2,3-bis[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]butane-1,4-diol (PubChem CID 153425788) has the molecular formula C20H50O6Si4 and a molecular weight of 498.96 g/mol. Its IUPAC name is (2S,3R)-2,3-bis[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]butane-1,4-diol.
| Compound Name | (2S,3R)-2,3-bis[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]butane-1,4-diol |
|---|---|
| PubChem CID | 153425788 |
| Molecular Formula | C20H50O6Si4 |
| Molecular Weight | 498.96 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | (2S,3R)-2,3-bis[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]butane-1,4-diol |
| SMILES | C[Si](C)(C)O[Si](C)(C)CCCO[C@@H](CO)[C@@H](CO)OCCC[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C20H50O6Si4/c1-27(2,3)25-29(7,8)15-11-13-23-19(17-21)20(18-22)24-14-12-16-30(9,10)26-28(4,5)6/h19-22H,11-18H2,1-10H3/t19-,20+ |
| InChIKey | LDNQZUBLRXYYME-BGYRXZFFSA-N |
| XLogP | 4.63 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.96 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|