C46H118O14Si12 — CID 153425811
(2R,3R,4S,5S)-2,3,4,5-tetrakis[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]hexane-1,6-diol (PubChem CID 153425811) has the molecular formula C46H118O14Si12 and a molecular weight of 1232.47 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2,3,4,5-tetrakis[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]hexane-1,6-diol.
| Compound Name | (2R,3R,4S,5S)-2,3,4,5-tetrakis[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]hexane-1,6-diol |
|---|---|
| PubChem CID | 153425811 |
| Molecular Formula | C46H118O14Si12 |
| Molecular Weight | 1232.47 g/mol |
| Exact Mass | 1230.58 |
| IUPAC Name | (2R,3R,4S,5S)-2,3,4,5-tetrakis[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]hexane-1,6-diol |
| SMILES | C[Si](C)(C)O[Si](C)(CCCO[C@H]([C@H](OCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](CO)OCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](CO)OCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C46H118O14Si12/c1-61(2,3)53-69(25,54-62(4,5)6)37-29-33-49-43(41-47)45(51-35-31-39-71(27,57-65(13,14)15)58-66(16,17)18)46(52-36-32-40-72(28,59-67(19,20)21)60-68(22,23)24)44(42-48)50-34-30-38-70(26,55-63(7,8)9)56-64(10,11)12/h43-48H,29-42H2,1-28H3/t43-,44+,45-,46+ |
| InChIKey | AIEHDSDPPOBSBJ-GFEGKYNESA-N |
| XLogP | 13.17 |
| TPSA | 151.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1232.47 |
| LogP ≤ 5 | 13.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|