C22H50O4Si2 — CID 153425823
(2S,3R)-2,3-bis(3-triethylsilylpropoxy)butane-1,4-diol (PubChem CID 153425823) has the molecular formula C22H50O4Si2 and a molecular weight of 434.81 g/mol. Its IUPAC name is (2S,3R)-2,3-bis(3-triethylsilylpropoxy)butane-1,4-diol.
| Compound Name | (2S,3R)-2,3-bis(3-triethylsilylpropoxy)butane-1,4-diol |
|---|---|
| PubChem CID | 153425823 |
| Molecular Formula | C22H50O4Si2 |
| Molecular Weight | 434.81 g/mol |
| Exact Mass | 434.32 |
| IUPAC Name | (2S,3R)-2,3-bis(3-triethylsilylpropoxy)butane-1,4-diol |
| SMILES | CC[Si](CC)(CC)CCCO[C@@H](CO)[C@@H](CO)OCCC[Si](CC)(CC)CC |
| InChI | InChI=1S/C22H50O4Si2/c1-7-27(8-2,9-3)17-13-15-25-21(19-23)22(20-24)26-16-14-18-28(10-4,11-5)12-6/h21-24H,7-20H2,1-6H3/t21-,22+ |
| InChIKey | PBJLDIJHECTYJU-SZPZYZBQSA-N |
| XLogP | 5.54 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.81 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|