C24H62O8Si6 — CID 153425799
(2R,3S)-2,3-bis[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propoxy]butane-1,4-diol (PubChem CID 153425799) has the molecular formula C24H62O8Si6 and a molecular weight of 647.27 g/mol. Its IUPAC name is (2R,3S)-2,3-bis[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propoxy]butane-1,4-diol.
| Compound Name | (2R,3S)-2,3-bis[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propoxy]butane-1,4-diol |
|---|---|
| PubChem CID | 153425799 |
| Molecular Formula | C24H62O8Si6 |
| Molecular Weight | 647.27 g/mol |
| Exact Mass | 646.31 |
| IUPAC Name | (2R,3S)-2,3-bis[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propoxy]butane-1,4-diol |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCO[C@@H](CO)[C@@H](CO)OCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C24H62O8Si6/c1-33(2,3)29-37(11,12)31-35(7,8)19-15-17-27-23(21-25)24(22-26)28-18-16-20-36(9,10)32-38(13,14)30-34(4,5)6/h23-26H,15-22H2,1-14H3/t23-,24+ |
| InChIKey | LPIHRCDAFRSXIC-PSWAGMNNSA-N |
| XLogP | 6.07 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.27 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|