C80H188O16Si12 — CID 159017030
2,3,4,5-tetrakis[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]hexane-1,6-diol;2,3,4,5-tetrakis(3-triethylsilylpropoxy)hexane-1,6-diol (PubChem CID 159017030) has the molecular formula C80H188O16Si12 and a molecular weight of 1743.40 g/mol. Its IUPAC name is 2,3,4,5-tetrakis[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]hexane-1,6-diol;2,3,4,5-tetrakis(3-triethylsilylpropoxy)hexane-1,6-diol.
| Compound Name | 2,3,4,5-tetrakis[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]hexane-1,6-diol;2,3,4,5-tetrakis(3-triethylsilylpropoxy)hexane-1,6-diol |
|---|---|
| PubChem CID | 159017030 |
| Molecular Formula | C80H188O16Si12 |
| Molecular Weight | 1743.40 g/mol |
| Exact Mass | 1741.11 |
| IUPAC Name | 2,3,4,5-tetrakis[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]hexane-1,6-diol;2,3,4,5-tetrakis(3-triethylsilylpropoxy)hexane-1,6-diol |
| SMILES | CC[Si](CC)(CC)CCCOC(CO)C(OCCC[Si](CC)(CC)CC)C(OCCC[Si](CC)(CC)CC)C(CO)OCCC[Si](CC)(CC)CC.C[Si](C)(C)O[Si](C)(C)CCCOC(CO)C(OCCC[Si](C)(C)O[Si](C)(C)C)C(OCCC[Si](C)(C)O[Si](C)(C)C)C(CO)OCCC[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C42H94O6Si4.C38H94O10Si8/c1-13-49(14-2,15-3)33-25-29-45-39(37-43)41(47-31-27-35-51(19-7,20-8)21-9)42(48-32-28-36-52(22-10,23-11)24-12)40(38-44)46-30-26-34-50(16-4,17-5)18-6;1-49(2,3)45-53(13,14)29-21-25-41-35(33-39)37(43-27-23-31-55(17,18)47-51(7,8)9)38(44-28-24-32-56(19,20)48-52(10,11)12)36(34-40)42-26-22-30-54(15,16)46-50(4,5)6/h39-44H,13-38H2,1-12H3;35-40H,21-34H2,1-20H3 |
| InChIKey | JTFJBDDLNLFEOL-UHFFFAOYSA-N |
| XLogP | 22.40 |
| TPSA | 191.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 70 |
| Heavy Atoms | 108 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1743.40 |
| LogP ≤ 5 | 22.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|