C14H34O3Si2 — CID 140752158
3-(2-butoxyethoxy)propyl-dimethyl-trimethylsilyloxysilane (PubChem CID 140752158) has the molecular formula C14H34O3Si2 and a molecular weight of 306.60 g/mol. Its IUPAC name is 3-(2-butoxyethoxy)propyl-dimethyl-trimethylsilyloxysilane.
| Compound Name | 3-(2-butoxyethoxy)propyl-dimethyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 140752158 |
| Molecular Formula | C14H34O3Si2 |
| Molecular Weight | 306.60 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 3-(2-butoxyethoxy)propyl-dimethyl-trimethylsilyloxysilane |
| SMILES | CCCCOCCOCCC[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C14H34O3Si2/c1-7-8-10-15-12-13-16-11-9-14-19(5,6)17-18(2,3)4/h7-14H2,1-6H3 |
| InChIKey | FHSKNHJWGYZJIZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.60 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|