C27H64NO3Si3+ — CID 167595524
tributyl-[2-[3-[[[butyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]ethyl]azanium (PubChem CID 167595524) has the molecular formula C27H64NO3Si3+ and a molecular weight of 535.07 g/mol. Its IUPAC name is tributyl-[2-[3-[[[butyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]ethyl]azanium.
| Compound Name | tributyl-[2-[3-[[[butyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]ethyl]azanium |
|---|---|
| PubChem CID | 167595524 |
| Molecular Formula | C27H64NO3Si3+ |
| Molecular Weight | 535.07 g/mol |
| Exact Mass | 534.42 |
| IUPAC Name | tributyl-[2-[3-[[[butyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]ethyl]azanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCOCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCC |
| InChI | InChI=1S/C27H64NO3Si3/c1-11-15-20-28(21-16-12-2,22-17-13-3)23-25-29-24-19-27-33(7,8)31-34(9,10)30-32(5,6)26-18-14-4/h11-27H2,1-10H3/q+1 |
| InChIKey | XCQLDBVJVLQUJI-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.07 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|