C18H40O6Si3 — CID 58104910
2-[3-[[[butyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]ethyl ethenyl carbonate (PubChem CID 58104910) has the molecular formula C18H40O6Si3 and a molecular weight of 436.77 g/mol. Its IUPAC name is 2-[3-[[[butyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]ethyl ethenyl carbonate.
| Compound Name | 2-[3-[[[butyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]ethyl ethenyl carbonate |
|---|---|
| PubChem CID | 58104910 |
| Molecular Formula | C18H40O6Si3 |
| Molecular Weight | 436.77 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 2-[3-[[[butyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]ethyl ethenyl carbonate |
| SMILES | C=COC(=O)OCCOCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCC |
| InChI | InChI=1S/C18H40O6Si3/c1-9-11-16-25(3,4)23-27(7,8)24-26(5,6)17-12-13-20-14-15-22-18(19)21-10-2/h10H,2,9,11-17H2,1,3-8H3 |
| InChIKey | FJFUEJURDRPOSJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.77 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|