C14H32O6Si3 — CID 59309329
4-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxybutyl ethenyl carbonate (PubChem CID 59309329) has the molecular formula C14H32O6Si3 and a molecular weight of 380.66 g/mol. Its IUPAC name is 4-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxybutyl ethenyl carbonate.
| Compound Name | 4-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxybutyl ethenyl carbonate |
|---|---|
| PubChem CID | 59309329 |
| Molecular Formula | C14H32O6Si3 |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 4-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxybutyl ethenyl carbonate |
| SMILES | C=COC(=O)OCCCCO[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C14H32O6Si3/c1-9-16-14(15)17-12-10-11-13-18-22(5,6)20-23(7,8)19-21(2,3)4/h9H,1,10-13H2,2-8H3 |
| InChIKey | JYOXTUXONIGENI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|