C18H34O6Si2 — CID 58725535
ethenyl 5-[[4-ethenoxycarbonyloxybutyl(dimethyl)silyl]oxy-dimethylsilyl]pentanoate (PubChem CID 58725535) has the molecular formula C18H34O6Si2 and a molecular weight of 402.64 g/mol. Its IUPAC name is ethenyl 5-[[4-ethenoxycarbonyloxybutyl(dimethyl)silyl]oxy-dimethylsilyl]pentanoate.
| Compound Name | ethenyl 5-[[4-ethenoxycarbonyloxybutyl(dimethyl)silyl]oxy-dimethylsilyl]pentanoate |
|---|---|
| PubChem CID | 58725535 |
| Molecular Formula | C18H34O6Si2 |
| Molecular Weight | 402.64 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | ethenyl 5-[[4-ethenoxycarbonyloxybutyl(dimethyl)silyl]oxy-dimethylsilyl]pentanoate |
| SMILES | C=COC(=O)CCCC[Si](C)(C)O[Si](C)(C)CCCCOC(=O)OC=C |
| InChI | InChI=1S/C18H34O6Si2/c1-7-21-17(19)13-9-11-15-25(3,4)24-26(5,6)16-12-10-14-23-18(20)22-8-2/h7-8H,1-2,9-16H2,3-6H3 |
| InChIKey | IOYBDAHKLLDHDF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.64 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|