C20H44O8Si3 — CID 91571550
4-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]butyl ethenyl carbonate;ethane;ethenyl methyl carbonate (PubChem CID 91571550) has the molecular formula C20H44O8Si3 and a molecular weight of 496.82 g/mol. Its IUPAC name is 4-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]butyl ethenyl carbonate;ethane;ethenyl methyl carbonate.
| Compound Name | 4-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]butyl ethenyl carbonate;ethane;ethenyl methyl carbonate |
|---|---|
| PubChem CID | 91571550 |
| Molecular Formula | C20H44O8Si3 |
| Molecular Weight | 496.82 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 4-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]butyl ethenyl carbonate;ethane;ethenyl methyl carbonate |
| SMILES | C=COC(=O)OC.C=COC(=O)OCCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C.CC |
| InChI | InChI=1S/C14H32O5Si3.C4H6O3.C2H6/c1-9-16-14(15)17-12-10-11-13-21(5,6)19-22(7,8)18-20(2,3)4;1-3-7-4(5)6-2;1-2/h9H,1,10-13H2,2-8H3;3H,1H2,2H3;1-2H3 |
| InChIKey | LOHGYNUGEBKBFX-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.82 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|