C24H48O6Si3 — CID 89309257
6-[[[dimethyl(6-prop-2-enoyloxyhexyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]hexyl prop-2-enoate (PubChem CID 89309257) has the molecular formula C24H48O6Si3 and a molecular weight of 516.90 g/mol. Its IUPAC name is 6-[[[dimethyl(6-prop-2-enoyloxyhexyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]hexyl prop-2-enoate.
| Compound Name | 6-[[[dimethyl(6-prop-2-enoyloxyhexyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 89309257 |
| Molecular Formula | C24H48O6Si3 |
| Molecular Weight | 516.90 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | 6-[[[dimethyl(6-prop-2-enoyloxyhexyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCCCCOC(=O)C=C |
| InChI | InChI=1S/C24H48O6Si3/c1-9-23(25)27-19-15-11-13-17-21-31(3,4)29-33(7,8)30-32(5,6)22-18-14-12-16-20-28-24(26)10-2/h9-10H,1-2,11-22H2,3-8H3 |
| InChIKey | FYXRQBNLWCNMQX-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.90 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|