C27H52O9Si4 — CID 166010478
3-[[bis[[dimethyl(3-prop-2-enoyloxypropyl)silyl]oxy]-propylsilyl]oxy-dimethylsilyl]propyl prop-2-enoate (PubChem CID 166010478) has the molecular formula C27H52O9Si4 and a molecular weight of 633.05 g/mol. Its IUPAC name is 3-[[bis[[dimethyl(3-prop-2-enoyloxypropyl)silyl]oxy]-propylsilyl]oxy-dimethylsilyl]propyl prop-2-enoate.
| Compound Name | 3-[[bis[[dimethyl(3-prop-2-enoyloxypropyl)silyl]oxy]-propylsilyl]oxy-dimethylsilyl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 166010478 |
| Molecular Formula | C27H52O9Si4 |
| Molecular Weight | 633.05 g/mol |
| Exact Mass | 632.27 |
| IUPAC Name | 3-[[bis[[dimethyl(3-prop-2-enoyloxypropyl)silyl]oxy]-propylsilyl]oxy-dimethylsilyl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC[Si](C)(C)O[Si](CCC)(O[Si](C)(C)CCCOC(=O)C=C)O[Si](C)(C)CCCOC(=O)C=C |
| InChI | InChI=1S/C27H52O9Si4/c1-11-21-40(34-37(5,6)22-15-18-31-25(28)12-2,35-38(7,8)23-16-19-32-26(29)13-3)36-39(9,10)24-17-20-33-27(30)14-4/h12-14H,2-4,11,15-24H2,1,5-10H3 |
| InChIKey | NPKHQURSYHGKCO-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.05 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|