C21H39F9O5Si4 — CID 141294200
3-tris[[dimethyl(3,3,3-trifluoropropyl)silyl]oxy]silylpropyl prop-2-enoate (PubChem CID 141294200) has the molecular formula C21H39F9O5Si4 and a molecular weight of 654.86 g/mol. Its IUPAC name is 3-tris[[dimethyl(3,3,3-trifluoropropyl)silyl]oxy]silylpropyl prop-2-enoate.
| Compound Name | 3-tris[[dimethyl(3,3,3-trifluoropropyl)silyl]oxy]silylpropyl prop-2-enoate |
|---|---|
| PubChem CID | 141294200 |
| Molecular Formula | C21H39F9O5Si4 |
| Molecular Weight | 654.86 g/mol |
| Exact Mass | 654.17 |
| IUPAC Name | 3-tris[[dimethyl(3,3,3-trifluoropropyl)silyl]oxy]silylpropyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC[Si](O[Si](C)(C)CCC(F)(F)F)(O[Si](C)(C)CCC(F)(F)F)O[Si](C)(C)CCC(F)(F)F |
| InChI | InChI=1S/C21H39F9O5Si4/c1-8-18(31)32-13-9-14-39(33-36(2,3)15-10-19(22,23)24,34-37(4,5)16-11-20(25,26)27)35-38(6,7)17-12-21(28,29)30/h8H,1,9-17H2,2-7H3 |
| InChIKey | MTSYCLQAXATESL-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.86 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|