C18H36O11Si4 — CID 142752557
3-tris[[ethenyl(dimethoxy)silyl]oxy]silylpropyl prop-2-enoate (PubChem CID 142752557) has the molecular formula C18H36O11Si4 and a molecular weight of 540.82 g/mol. Its IUPAC name is 3-tris[[ethenyl(dimethoxy)silyl]oxy]silylpropyl prop-2-enoate.
| Compound Name | 3-tris[[ethenyl(dimethoxy)silyl]oxy]silylpropyl prop-2-enoate |
|---|---|
| PubChem CID | 142752557 |
| Molecular Formula | C18H36O11Si4 |
| Molecular Weight | 540.82 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | 3-tris[[ethenyl(dimethoxy)silyl]oxy]silylpropyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC[Si](O[Si](C=C)(OC)OC)(O[Si](C=C)(OC)OC)O[Si](C=C)(OC)OC |
| InChI | InChI=1S/C18H36O11Si4/c1-11-18(19)26-16-15-17-33(27-30(12-2,20-5)21-6,28-31(13-3,22-7)23-8)29-32(14-4,24-9)25-10/h11-14H,1-4,15-17H2,5-10H3 |
| InChIKey | JMFMBLSCFKPBDK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.82 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|