C18H42O6Si4 — CID 59642122
3-[3-tris(trimethylsilyloxy)silylpropoxy]propyl prop-2-enoate (PubChem CID 59642122) has the molecular formula C18H42O6Si4 and a molecular weight of 466.87 g/mol. Its IUPAC name is 3-[3-tris(trimethylsilyloxy)silylpropoxy]propyl prop-2-enoate.
| Compound Name | 3-[3-tris(trimethylsilyloxy)silylpropoxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 59642122 |
| Molecular Formula | C18H42O6Si4 |
| Molecular Weight | 466.87 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 3-[3-tris(trimethylsilyloxy)silylpropoxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C18H42O6Si4/c1-11-18(19)21-16-12-14-20-15-13-17-28(22-25(2,3)4,23-26(5,6)7)24-27(8,9)10/h11H,1,12-17H2,2-10H3 |
| InChIKey | VLVQIEBUSNEVEH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.87 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|