C13H35NO5Si4 — CID 23366258
3-tris(trimethylsilyloxy)silylpropyl carbamate (PubChem CID 23366258) has the molecular formula C13H35NO5Si4 and a molecular weight of 397.77 g/mol. Its IUPAC name is 3-tris(trimethylsilyloxy)silylpropyl carbamate.
| Compound Name | 3-tris(trimethylsilyloxy)silylpropyl carbamate |
|---|---|
| PubChem CID | 23366258 |
| Molecular Formula | C13H35NO5Si4 |
| Molecular Weight | 397.77 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 3-tris(trimethylsilyloxy)silylpropyl carbamate |
| SMILES | C[Si](C)(C)O[Si](CCCOC(N)=O)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C13H35NO5Si4/c1-20(2,3)17-23(18-21(4,5)6,19-22(7,8)9)12-10-11-16-13(14)15/h10-12H2,1-9H3,(H2,14,15) |
| InChIKey | XFDLZBABNYZTQC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.77 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|