C20H46O8Si4 — CID 139675871
1-O-tert-butyl 4-O-[3-tris(trimethylsilyloxy)silylpropyl] 2-hydroxybutanedioate (PubChem CID 139675871) has the molecular formula C20H46O8Si4 and a molecular weight of 526.92 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-[3-tris(trimethylsilyloxy)silylpropyl] 2-hydroxybutanedioate.
| Compound Name | 1-O-tert-butyl 4-O-[3-tris(trimethylsilyloxy)silylpropyl] 2-hydroxybutanedioate |
|---|---|
| PubChem CID | 139675871 |
| Molecular Formula | C20H46O8Si4 |
| Molecular Weight | 526.92 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 1-O-tert-butyl 4-O-[3-tris(trimethylsilyloxy)silylpropyl] 2-hydroxybutanedioate |
| SMILES | CC(C)(C)OC(=O)C(O)CC(=O)OCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C20H46O8Si4/c1-20(2,3)25-19(23)17(21)16-18(22)24-14-13-15-32(26-29(4,5)6,27-30(7,8)9)28-31(10,11)12/h17,21H,13-16H2,1-12H3 |
| InChIKey | XMMCMSYGCCNTLW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.92 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|