C34H92O14Si13 — CID 54059170
3-tris[tris(trimethylsilyloxy)silyloxy]silylpropyl 2-methylprop-2-enoate (PubChem CID 54059170) has the molecular formula C34H92O14Si13 and a molecular weight of 1090.21 g/mol. Its IUPAC name is 3-tris[tris(trimethylsilyloxy)silyloxy]silylpropyl 2-methylprop-2-enoate.
| Compound Name | 3-tris[tris(trimethylsilyloxy)silyloxy]silylpropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 54059170 |
| Molecular Formula | C34H92O14Si13 |
| Molecular Weight | 1090.21 g/mol |
| Exact Mass | 1088.35 |
| IUPAC Name | 3-tris[tris(trimethylsilyloxy)silyloxy]silylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)(O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C34H92O14Si13/c1-33(2)34(35)36-31-30-32-58(46-59(37-49(3,4)5,38-50(6,7)8)39-51(9,10)11,47-60(40-52(12,13)14,41-53(15,16)17)42-54(18,19)20)48-61(43-55(21,22)23,44-56(24,25)26)45-57(27,28)29/h1,30-32H2,2-29H3 |
| InChIKey | LYKUGXKIXVDALZ-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 137.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1090.21 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|