C16H34O3Si2 — CID 18739228
3-[dipropyl(trimethylsilyloxy)silyl]propyl 2-methylprop-2-enoate (PubChem CID 18739228) has the molecular formula C16H34O3Si2 and a molecular weight of 330.62 g/mol. Its IUPAC name is 3-[dipropyl(trimethylsilyloxy)silyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[dipropyl(trimethylsilyloxy)silyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 18739228 |
| Molecular Formula | C16H34O3Si2 |
| Molecular Weight | 330.62 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 3-[dipropyl(trimethylsilyloxy)silyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](CCC)(CCC)O[Si](C)(C)C |
| InChI | InChI=1S/C16H34O3Si2/c1-8-12-21(13-9-2,19-20(5,6)7)14-10-11-18-16(17)15(3)4/h3,8-14H2,1-2,4-7H3 |
| InChIKey | XHWUYCXYNGKCBT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|