C32H70O5Si4 — CID 171058420
tris(tripropylsilyloxy)silylmethyl 2-methylprop-2-enoate (PubChem CID 171058420) has the molecular formula C32H70O5Si4 and a molecular weight of 647.25 g/mol. Its IUPAC name is tris(tripropylsilyloxy)silylmethyl 2-methylprop-2-enoate.
| Compound Name | tris(tripropylsilyloxy)silylmethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 171058420 |
| Molecular Formula | C32H70O5Si4 |
| Molecular Weight | 647.25 g/mol |
| Exact Mass | 646.43 |
| IUPAC Name | tris(tripropylsilyloxy)silylmethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC[Si](O[Si](CCC)(CCC)CCC)(O[Si](CCC)(CCC)CCC)O[Si](CCC)(CCC)CCC |
| InChI | InChI=1S/C32H70O5Si4/c1-12-21-38(22-13-2,23-14-3)35-41(30-34-32(33)31(10)11,36-39(24-15-4,25-16-5)26-17-6)37-40(27-18-7,28-19-8)29-20-9/h10,12-30H2,1-9,11H3 |
| InChIKey | CLUYWTCUHMWQCV-UHFFFAOYSA-N |
| XLogP | 11.16 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.25 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|