C33H72O5Si4 — CID 171058419
2-tris(tripropylsilyloxy)silylethyl 2-methylprop-2-enoate (PubChem CID 171058419) has the molecular formula C33H72O5Si4 and a molecular weight of 661.28 g/mol. Its IUPAC name is 2-tris(tripropylsilyloxy)silylethyl 2-methylprop-2-enoate.
| Compound Name | 2-tris(tripropylsilyloxy)silylethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 171058419 |
| Molecular Formula | C33H72O5Si4 |
| Molecular Weight | 661.28 g/mol |
| Exact Mass | 660.45 |
| IUPAC Name | 2-tris(tripropylsilyloxy)silylethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC[Si](O[Si](CCC)(CCC)CCC)(O[Si](CCC)(CCC)CCC)O[Si](CCC)(CCC)CCC |
| InChI | InChI=1S/C33H72O5Si4/c1-12-22-39(23-13-2,24-14-3)36-42(31-21-35-33(34)32(10)11,37-40(25-15-4,26-16-5)27-17-6)38-41(28-18-7,29-19-8)30-20-9/h10,12-31H2,1-9,11H3 |
| InChIKey | QCZPNZMHFRRUQE-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.28 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|