C46H122O14Si16 — CID 88568225
3-tris[[dimethyl-[2-tris(trimethylsilyloxy)silylethyl]silyl]oxy]silylpropyl 2-methylprop-2-enoate (PubChem CID 88568225) has the molecular formula C46H122O14Si16 and a molecular weight of 1348.84 g/mol. Its IUPAC name is 3-tris[[dimethyl-[2-tris(trimethylsilyloxy)silylethyl]silyl]oxy]silylpropyl 2-methylprop-2-enoate.
| Compound Name | 3-tris[[dimethyl-[2-tris(trimethylsilyloxy)silylethyl]silyl]oxy]silylpropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88568225 |
| Molecular Formula | C46H122O14Si16 |
| Molecular Weight | 1348.84 g/mol |
| Exact Mass | 1346.51 |
| IUPAC Name | 3-tris[[dimethyl-[2-tris(trimethylsilyloxy)silylethyl]silyl]oxy]silylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](O[Si](C)(C)CC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)(O[Si](C)(C)CC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)CC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C46H122O14Si16/c1-45(2)46(47)48-37-36-38-73(58-70(30,31)39-42-74(49-61(3,4)5,50-62(6,7)8)51-63(9,10)11,59-71(32,33)40-43-75(52-64(12,13)14,53-65(15,16)17)54-66(18,19)20)60-72(34,35)41-44-76(55-67(21,22)23,56-68(24,25)26)57-69(27,28)29/h1,36-44H2,2-35H3 |
| InChIKey | JDHHNCWIHSOUMV-UHFFFAOYSA-N |
| XLogP | 16.58 |
| TPSA | 137.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1348.84 |
| LogP ≤ 5 | 16.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|