C34H72O9Si7 — CID 149435617
3-[[bis[methyl-[3-(2-methylprop-2-enoyloxy)propyl]-trimethylsilyloxysilyl]-silylmethyl]-methyl-trimethylsilyloxysilyl]propyl 2-methylprop-2-enoate (PubChem CID 149435617) has the molecular formula C34H72O9Si7 and a molecular weight of 821.54 g/mol. Its IUPAC name is 3-[[bis[methyl-[3-(2-methylprop-2-enoyloxy)propyl]-trimethylsilyloxysilyl]-silylmethyl]-methyl-trimethylsilyloxysilyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[[bis[methyl-[3-(2-methylprop-2-enoyloxy)propyl]-trimethylsilyloxysilyl]-silylmethyl]-methyl-trimethylsilyloxysilyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 149435617 |
| Molecular Formula | C34H72O9Si7 |
| Molecular Weight | 821.54 g/mol |
| Exact Mass | 820.36 |
| IUPAC Name | 3-[[bis[methyl-[3-(2-methylprop-2-enoyloxy)propyl]-trimethylsilyloxysilyl]-silylmethyl]-methyl-trimethylsilyloxysilyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](C)(O[Si](C)(C)C)C([SiH3])([Si](C)(CCCOC(=O)C(=C)C)O[Si](C)(C)C)[Si](C)(CCCOC(=O)C(=C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C34H72O9Si7/c1-28(2)31(35)38-22-19-25-48(16,41-45(7,8)9)34(44,49(17,42-46(10,11)12)26-20-23-39-32(36)29(3)4)50(18,43-47(13,14)15)27-21-24-40-33(37)30(5)6/h1,3,5,19-27H2,2,4,6-18,44H3 |
| InChIKey | FPECRNOELNNTGL-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.54 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|