C19H42O7Si4 — CID 173409415
4-[[3-but-2-enoyloxypropyl-bis(trimethylsilyloxy)silyl]oxy-dimethylsilyl]butanoic acid (PubChem CID 173409415) has the molecular formula C19H42O7Si4 and a molecular weight of 494.88 g/mol. Its IUPAC name is 4-[[3-but-2-enoyloxypropyl-bis(trimethylsilyloxy)silyl]oxy-dimethylsilyl]butanoic acid.
| Compound Name | 4-[[3-but-2-enoyloxypropyl-bis(trimethylsilyloxy)silyl]oxy-dimethylsilyl]butanoic acid |
|---|---|
| PubChem CID | 173409415 |
| Molecular Formula | C19H42O7Si4 |
| Molecular Weight | 494.88 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 4-[[3-but-2-enoyloxypropyl-bis(trimethylsilyloxy)silyl]oxy-dimethylsilyl]butanoic acid |
| SMILES | CC=CC(=O)OCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)CCCC(=O)O |
| InChI | InChI=1S/C19H42O7Si4/c1-10-13-19(22)23-15-12-17-30(24-27(2,3)4,25-28(5,6)7)26-29(8,9)16-11-14-18(20)21/h10,13H,11-12,14-17H2,1-9H3,(H,20,21) |
| InChIKey | FCYWXZXNGXTDAS-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.88 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|