C28H68O10Si8 — CID 173321361
bis[3-[dimethyl-[methyl-bis(trimethylsilyloxy)silyl]oxysilyl]propyl] but-2-enedioate (PubChem CID 173321361) has the molecular formula C28H68O10Si8 and a molecular weight of 789.53 g/mol. Its IUPAC name is bis[3-[dimethyl-[methyl-bis(trimethylsilyloxy)silyl]oxysilyl]propyl] but-2-enedioate.
| Compound Name | bis[3-[dimethyl-[methyl-bis(trimethylsilyloxy)silyl]oxysilyl]propyl] but-2-enedioate |
|---|---|
| PubChem CID | 173321361 |
| Molecular Formula | C28H68O10Si8 |
| Molecular Weight | 789.53 g/mol |
| Exact Mass | 788.30 |
| IUPAC Name | bis[3-[dimethyl-[methyl-bis(trimethylsilyloxy)silyl]oxysilyl]propyl] but-2-enedioate |
| SMILES | C[Si](C)(C)O[Si](C)(O[Si](C)(C)C)O[Si](C)(C)CCCOC(=O)C=CC(=O)OCCC[Si](C)(C)O[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C28H68O10Si8/c1-39(2,3)33-45(17,34-40(4,5)6)37-43(13,14)25-19-23-31-27(29)21-22-28(30)32-24-20-26-44(15,16)38-46(18,35-41(7,8)9)36-42(10,11)12/h21-22H,19-20,23-26H2,1-18H3 |
| InChIKey | LEODULLQBYNGQS-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.53 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|