C10H18O4Si — CID 91126449
4-oxo-4-(3-trimethylsilylpropoxy)but-2-enoic acid (PubChem CID 91126449) has the molecular formula C10H18O4Si and a molecular weight of 230.34 g/mol. Its IUPAC name is 4-oxo-4-(3-trimethylsilylpropoxy)but-2-enoic acid.
| Compound Name | 4-oxo-4-(3-trimethylsilylpropoxy)but-2-enoic acid |
|---|---|
| PubChem CID | 91126449 |
| Molecular Formula | C10H18O4Si |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 4-oxo-4-(3-trimethylsilylpropoxy)but-2-enoic acid |
| SMILES | C[Si](C)(C)CCCOC(=O)C=CC(=O)O |
| InChI | InChI=1S/C10H18O4Si/c1-15(2,3)8-4-7-14-10(13)6-5-9(11)12/h5-6H,4,7-8H2,1-3H3,(H,11,12) |
| InChIKey | BVMFCKRIQQNYND-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|