About (Z)-4-decoxy-4-oxobut-2-enoic acid;hydrochloride
(Z)-4-decoxy-4-oxobut-2-enoic acid;hydrochloride (PubChem CID 87872279) has the molecular formula C14H25ClO4
and a molecular weight of 292.80 g/mol. Its IUPAC name is (Z)-4-decoxy-4-oxobut-2-enoic acid;hydrochloride.
Molecular Properties
| Compound Name | (Z)-4-decoxy-4-oxobut-2-enoic acid;hydrochloride |
| PubChem CID | 87872279 |
| Molecular Formula | C14H25ClO4 |
| Molecular Weight | 292.80 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | (Z)-4-decoxy-4-oxobut-2-enoic acid;hydrochloride |
| SMILES | CCCCCCCCCCOC(=O)/C=C\C(=O)O.Cl |
| InChI | InChI=1S/C14H24O4.ClH/c1-2-3-4-5-6-7-8-9-12-18-14(17)11-10-13(15)16;/h10-11H,2-9,12H2,1H3,(H,15,16);1H/b11-10-; |
| InChIKey | PGHNYCVCQWIONE-GMFCBQQYSA-N |
| XLogP | 3.73 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.80 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-decoxy-4-oxobut-2-enoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-decoxy-4-oxobut-2-enoic acid;hydrochloride?
The IUPAC name of (Z)-4-decoxy-4-oxobut-2-enoic acid;hydrochloride (CID 87872279) is (Z)-4-decoxy-4-oxobut-2-enoic acid;hydrochloride.
What is the SMILES notation for (Z)-4-decoxy-4-oxobut-2-enoic acid;hydrochloride?
The canonical SMILES for (Z)-4-decoxy-4-oxobut-2-enoic acid;hydrochloride is CCCCCCCCCCOC(=O)/C=C\C(=O)O.Cl.
What is the InChIKey of (Z)-4-decoxy-4-oxobut-2-enoic acid;hydrochloride?
The InChIKey is PGHNYCVCQWIONE-GMFCBQQYSA-N. The full InChI is InChI=1S/C14H24O4.ClH/c1-2-3-4-5-6-7-8-9-12-18-14(17)11-10-13(15)16;/h10-11H,2-9,12H2,1H3,(H,15,16);1H/b11-10-;.
What are the key properties of (Z)-4-decoxy-4-oxobut-2-enoic acid;hydrochloride?
(Z)-4-decoxy-4-oxobut-2-enoic acid;hydrochloride has a molecular weight of 292.80 g/mol, XLogP of 3.73, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-decoxy-4-oxobut-2-enoic acid;hydrochloride is sourced from PubChem (CID 87872279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).